C20H30O4 — CID 75954571
4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-dien-17-ol (PubChem CID 75954571) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-dien-17-ol.
| Compound Name | 4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-dien-17-ol |
|---|---|
| PubChem CID | 75954571 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-dien-17-ol |
| SMILES | CC1=CC2OC(O)C3(C)OC23CCC(C)=CCCC2(C)OC2CC1 |
| InChI | InChI=1S/C20H30O4/c1-13-6-5-10-18(3)15(23-18)8-7-14(2)12-16-20(11-9-13)19(4,24-20)17(21)22-16/h6,12,15-17,21H,5,7-11H2,1-4H3 |
| InChIKey | NPQGFYMXLKPQTD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|