C24H30N2O2 — CID 7595987
(5R)-3-[(4-tert-butylphenyl)methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 7595987) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (5R)-3-[(4-tert-butylphenyl)methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(4-tert-butylphenyl)methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7595987 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (5R)-3-[(4-tert-butylphenyl)methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc([C@@]2(C)NC(=O)N(Cc3ccc(C(C)(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-16(2)18-9-13-20(14-10-18)24(6)21(27)26(22(28)25-24)15-17-7-11-19(12-8-17)23(3,4)5/h7-14,16H,15H2,1-6H3,(H,25,28)/t24-/m1/s1 |
| InChIKey | KRIDIEKALIXTDA-XMMPIXPASA-N |
| XLogP | 5.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|