C15H14FN2O6S2- — CID 7596041
2-[2-[[(3aS,6aR)-3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetate (PubChem CID 7596041) has the molecular formula C15H14FN2O6S2- and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-[2-[[(3aS,6aR)-3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[[(3aS,6aR)-3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 7596041 |
| Molecular Formula | C15H14FN2O6S2- |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 2-[2-[[(3aS,6aR)-3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetate |
| SMILES | O=C([O-])COCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1F |
| InChI | InChI=1S/C15H15FN2O6S2/c16-9-3-1-2-4-10(9)18-11-7-26(22,23)8-12(11)25-15(18)17-13(19)5-24-6-14(20)21/h1-4,11-12H,5-8H2,(H,20,21)/p-1/b17-15-/t11-,12-/m0/s1 |
| InChIKey | FGFSDGGPUFKKEF-GHBQHLJCSA-M |
| XLogP | -0.81 |
| TPSA | 116.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|