C19H27N4O3S+ — CID 7596428
[(1S)-2-[[(5S)-4,6-dioxo-1-propyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-1-(4-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 7596428) has the molecular formula C19H27N4O3S+ and a molecular weight of 391.52 g/mol. Its IUPAC name is [(1S)-2-[[(5S)-4,6-dioxo-1-propyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-1-(4-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[[(5S)-4,6-dioxo-1-propyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-1-(4-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7596428 |
| Molecular Formula | C19H27N4O3S+ |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [(1S)-2-[[(5S)-4,6-dioxo-1-propyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-1-(4-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | CCCN1C(=O)[C@@H](/C=N/C[C@H](c2ccc(OC)cc2)[NH+](C)C)C(=O)NC1=S |
| InChI | InChI=1S/C19H26N4O3S/c1-5-10-23-18(25)15(17(24)21-19(23)27)11-20-12-16(22(2)3)13-6-8-14(26-4)9-7-13/h6-9,11,15-16H,5,10,12H2,1-4H3,(H,21,24,27)/p+1/b20-11+/t15-,16+/m0/s1 |
| InChIKey | JZNUVRVOXZSXEN-PWIMYCEHSA-O |
| XLogP | 0.22 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|