C12H9Cl2N3O — CID 75967913
4-chloro-N-[(4-chlorophenyl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 75967913) has the molecular formula C12H9Cl2N3O and a molecular weight of 282.13 g/mol. Its IUPAC name is 4-chloro-N-[(4-chlorophenyl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(4-chlorophenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75967913 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 4-chloro-N-[(4-chlorophenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C12H9Cl2N3O/c13-9-3-1-8(2-4-9)6-16-17-12(18)11-5-10(14)7-15-11/h1-7,15H,(H,17,18) |
| InChIKey | FCNYVBYIIJXYGX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|