C20H22O5 — CID 75968312
5,7,11-trihydroxy-4,4,9,11b-tetramethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one (PubChem CID 75968312) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 5,7,11-trihydroxy-4,4,9,11b-tetramethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one.
| Compound Name | 5,7,11-trihydroxy-4,4,9,11b-tetramethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one |
|---|---|
| PubChem CID | 75968312 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5,7,11-trihydroxy-4,4,9,11b-tetramethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one |
| SMILES | Cc1cc2c(O)c3c(c(O)c2o1)C1(C)CCCC(C)(C)C1=C(O)C3=O |
| InChI | InChI=1S/C20H22O5/c1-9-8-10-13(21)11-12(15(23)17(10)25-9)20(4)7-5-6-19(2,3)18(20)16(24)14(11)22/h8,21,23-24H,5-7H2,1-4H3 |
| InChIKey | WYFPXHKGBRCNFN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|