C19H14FNO — CID 759702
N-(1,2-dihydroacenaphthylen-5-yl)-4-fluorobenzamide (PubChem CID 759702) has the molecular formula C19H14FNO and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-4-fluorobenzamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 759702 |
| Molecular Formula | C19H14FNO |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc2c3c(cccc13)CC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FNO/c20-15-9-6-14(7-10-15)19(22)21-17-11-8-13-5-4-12-2-1-3-16(17)18(12)13/h1-3,6-11H,4-5H2,(H,21,22) |
| InChIKey | VROYHHCUXRMIQY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |