C13H15ClN2O2S2 — CID 75973852
3-(2-aminoethyl)-5-[(3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 75973852) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-[(3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | 3-(2-aminoethyl)-5-[(3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 75973852 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-(2-aminoethyl)-5-[(3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | COc1cccc(C=C2SC(=S)N(CCN)C2=O)c1.Cl |
| InChI | InChI=1S/C13H14N2O2S2.ClH/c1-17-10-4-2-3-9(7-10)8-11-12(16)15(6-5-14)13(18)19-11;/h2-4,7-8H,5-6,14H2,1H3;1H |
| InChIKey | RVWBYCAUEIHTMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|