C18H20FN5O2 — CID 75974170
2-[4-[(4-fluorophenyl)methyl]-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-2-yl]acetonitrile (PubChem CID 75974170) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-2-yl]acetonitrile.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 75974170 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-2-yl]acetonitrile |
| SMILES | N#CCN1NC2N(Cc3ccc(F)cc3)C(=O)C3CCCCC3N2C1=O |
| InChI | InChI=1S/C18H20FN5O2/c19-13-7-5-12(6-8-13)11-22-16(25)14-3-1-2-4-15(14)24-17(22)21-23(10-9-20)18(24)26/h5-8,14-15,17,21H,1-4,10-11H2 |
| InChIKey | AOTUFGYWQUBFLE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|