C19H21ClO4 — CID 75981430
1-(4-chlorophenyl)ethyl 3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 75981430) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)ethyl 3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | 1-(4-chlorophenyl)ethyl 3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 75981430 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(4-chlorophenyl)ethyl 3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OC(C)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H21ClO4/c1-13(15-6-8-16(20)9-7-15)24-19(21)11-5-14-4-10-17(22-2)18(12-14)23-3/h4,6-10,12-13H,5,11H2,1-3H3 |
| InChIKey | XEDAFBQTFKKNJB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |