About 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one
2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one (PubChem CID 75985549) has the molecular formula C13H16ClN3O3
and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one |
| PubChem CID | 75985549 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one |
| SMILES | CC1COCCN1c1nc(Cl)nc2c1C(=O)OC2(C)C |
| InChI | InChI=1S/C13H16ClN3O3/c1-7-6-19-5-4-17(7)10-8-9(15-12(14)16-10)13(2,3)20-11(8)18/h7H,4-6H2,1-3H3 |
| InChIKey | YAMVKTOLXRPOBX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one?
The IUPAC name of 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one (CID 75985549) is 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one is CC1COCCN1c1nc(Cl)nc2c1C(=O)OC2(C)C.
What is the InChIKey of 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one?
The InChIKey is YAMVKTOLXRPOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O3/c1-7-6-19-5-4-17(7)10-8-9(15-12(14)16-10)13(2,3)20-11(8)18/h7H,4-6H2,1-3H3.
What are the key properties of 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one?
2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one has a molecular weight of 297.74 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7,7-dimethyl-4-(3-methylmorpholin-4-yl)furo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 75985549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).