About 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole
1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole (PubChem CID 759866) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole.
Molecular Properties
| Compound Name | 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole |
| PubChem CID | 759866 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole |
| SMILES | c1nnnn1C[C@@H]1CCOCO1 |
| InChI | InChI=1S/C6H10N4O2/c1-2-11-5-12-6(1)3-10-4-7-8-9-10/h4,6H,1-3,5H2/t6-/m0/s1 |
| InChIKey | YOGCLMNFUGZTMS-LURJTMIESA-N |
| XLogP | -0.56 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole?
The IUPAC name of 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole (CID 759866) is 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole.
What is the SMILES notation for 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole?
The canonical SMILES for 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole is c1nnnn1C[C@@H]1CCOCO1.
What is the InChIKey of 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole?
The InChIKey is YOGCLMNFUGZTMS-LURJTMIESA-N. The full InChI is InChI=1S/C6H10N4O2/c1-2-11-5-12-6(1)3-10-4-7-8-9-10/h4,6H,1-3,5H2/t6-/m0/s1.
What are the key properties of 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole?
1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole has a molecular weight of 170.17 g/mol, XLogP of -0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4S)-1,3-dioxan-4-yl]methyl]tetrazole is sourced from PubChem (CID 759866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).