C17H15N5O3 — CID 75987264
4-[5-(4-ethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-3-methylbenzonitrile (PubChem CID 75987264) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-[5-(4-ethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-3-methylbenzonitrile.
| Compound Name | 4-[5-(4-ethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-3-methylbenzonitrile |
|---|---|
| PubChem CID | 75987264 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[5-(4-ethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-3-methylbenzonitrile |
| SMILES | CCC1NC(=O)N(c2cnc(Oc3ccc(C#N)cc3C)nc2)C1=O |
| InChI | InChI=1S/C17H15N5O3/c1-3-13-15(23)22(17(24)21-13)12-8-19-16(20-9-12)25-14-5-4-11(7-18)6-10(14)2/h4-6,8-9,13H,3H2,1-2H3,(H,21,24) |
| InChIKey | XNHVHUBNLMEZFO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|