About 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol
6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol (PubChem CID 75987722) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol.
Molecular Properties
| Compound Name | 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol |
| PubChem CID | 75987722 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)(O)C1CO1 |
| InChI | InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-15(4,16)14-11-17-14/h7,9,14,16H,5-6,8,10-11H2,1-4H3 |
| InChIKey | CLIDOAFOSTWHAW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol?
The IUPAC name of 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol (CID 75987722) is 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol.
What is the SMILES notation for 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol?
The canonical SMILES for 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol is CC(C)=CCCC(C)=CCCC(C)(O)C1CO1.
What is the InChIKey of 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol?
The InChIKey is CLIDOAFOSTWHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-15(4,16)14-11-17-14/h7,9,14,16H,5-6,8,10-11H2,1-4H3.
What are the key properties of 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol?
6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol has a molecular weight of 238.37 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethyl-2-(oxiran-2-yl)undeca-5,9-dien-2-ol is sourced from PubChem (CID 75987722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).