C20H17FN2O2 — CID 7598870
1-[(2-fluorophenyl)methyl]-N-(3-methylphenyl)-2-oxopyridine-3-carboxamide (PubChem CID 7598870) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-(3-methylphenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-(3-methylphenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 7598870 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-(3-methylphenyl)-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccn(Cc3ccccc3F)c2=O)c1 |
| InChI | InChI=1S/C20H17FN2O2/c1-14-6-4-8-16(12-14)22-19(24)17-9-5-11-23(20(17)25)13-15-7-2-3-10-18(15)21/h2-12H,13H2,1H3,(H,22,24) |
| InChIKey | ZHRLKFGWPAGNEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |