C21H20N2O5S — CID 7599119
[2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 2-(2-nitrophenyl)acetate (PubChem CID 7599119) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 7599119 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| SMILES | Cc1cc(C(=O)COC(=O)Cc2ccccc2[N+](=O)[O-])c(C)n1Cc1cccs1 |
| InChI | InChI=1S/C21H20N2O5S/c1-14-10-18(15(2)22(14)12-17-7-5-9-29-17)20(24)13-28-21(25)11-16-6-3-4-8-19(16)23(26)27/h3-10H,11-13H2,1-2H3 |
| InChIKey | QITYMFFFZYSFCU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|