C19H13F2N3O4 — CID 7599222
N-(2,5-difluorophenyl)-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 7599222) has the molecular formula C19H13F2N3O4 and a molecular weight of 385.33 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 7599222 |
| Molecular Formula | C19H13F2N3O4 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(2,5-difluorophenyl)-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1cccn(Cc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C19H13F2N3O4/c20-13-6-7-16(21)17(10-13)22-18(25)15-5-2-8-23(19(15)26)11-12-3-1-4-14(9-12)24(27)28/h1-10H,11H2,(H,22,25) |
| InChIKey | OWVBOIBOVIMEBS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|