C37H46ClN3O2 — CID 75992723
7-chloro-N-[2-[4-[(5,6-dimethoxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-1-yl]ethyl]-15-ethyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine (PubChem CID 75992723) has the molecular formula C37H46ClN3O2 and a molecular weight of 600.25 g/mol. Its IUPAC name is 7-chloro-N-[2-[4-[(5,6-dimethoxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-1-yl]ethyl]-15-ethyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine.
| Compound Name | 7-chloro-N-[2-[4-[(5,6-dimethoxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-1-yl]ethyl]-15-ethyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 75992723 |
| Molecular Formula | C37H46ClN3O2 |
| Molecular Weight | 600.25 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 7-chloro-N-[2-[4-[(5,6-dimethoxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-1-yl]ethyl]-15-ethyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
| SMILES | CCC1=CC2Cc3nc4cc(Cl)ccc4c(NCCN4CCC(CC5Cc6cc(OC)c(OC)cc6C5)CC4)c3C(C1)C2 |
| InChI | InChI=1S/C37H46ClN3O2/c1-4-23-13-26-18-29(15-23)36-33(19-26)40-32-22-30(38)5-6-31(32)37(36)39-9-12-41-10-7-24(8-11-41)14-25-16-27-20-34(42-2)35(43-3)21-28(27)17-25/h5-6,13,20-22,24-26,29H,4,7-12,14-19H2,1-3H3,(H,39,40) |
| InChIKey | PGEVOJWBZHSHAR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.25 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|