About ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate
ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate (PubChem CID 7601459) has the molecular formula C19H17F2NO7
and a molecular weight of 409.34 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate |
| PubChem CID | 7601459 |
| Molecular Formula | C19H17F2NO7 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2ccc(F)cc2F)oc(C)c1C(C)=O |
| InChI | InChI=1S/C19H17F2NO7/c1-4-27-19(26)16-15(9(2)23)10(3)29-17(16)22-14(24)8-28-18(25)12-6-5-11(20)7-13(12)21/h5-7H,4,8H2,1-3H3,(H,22,24) |
| InChIKey | PZTRHXMDTPRCRL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate?
The IUPAC name of ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate (CID 7601459) is ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate.
What is the SMILES notation for ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate?
The canonical SMILES for ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate is CCOC(=O)c1c(NC(=O)COC(=O)c2ccc(F)cc2F)oc(C)c1C(C)=O.
What is the InChIKey of ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate?
The InChIKey is PZTRHXMDTPRCRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NO7/c1-4-27-19(26)16-15(9(2)23)10(3)29-17(16)22-14(24)8-28-18(25)12-6-5-11(20)7-13(12)21/h5-7H,4,8H2,1-3H3,(H,22,24).
What are the key properties of ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate?
ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate has a molecular weight of 409.34 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-acetyl-2-[[2-(2,4-difluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate is sourced from PubChem (CID 7601459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).