About N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide
N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 760296) has the molecular formula C16H22N2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| PubChem CID | 760296 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H22N2S/c19-16(17-15-8-2-1-3-9-15)18-11-10-13-6-4-5-7-14(13)12-18/h4-7,15H,1-3,8-12H2,(H,17,19) |
| InChIKey | WRQGZJRDFGPJKX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The IUPAC name of N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (CID 760296) is N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
What is the SMILES notation for N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The canonical SMILES for N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide is S=C(NC1CCCCC1)N1CCc2ccccc2C1.
What is the InChIKey of N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The InChIKey is WRQGZJRDFGPJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2S/c19-16(17-15-8-2-1-3-9-15)18-11-10-13-6-4-5-7-14(13)12-18/h4-7,15H,1-3,8-12H2,(H,17,19).
What are the key properties of N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide has a molecular weight of 274.43 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide is sourced from PubChem (CID 760296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).