C18H25N5OS — CID 7603409
N-(4-piperidin-1-ylphenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 7603409) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7603409 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CC(C)n1cnnc1SCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25N5OS/c1-14(2)23-13-19-21-18(23)25-12-17(24)20-15-6-8-16(9-7-15)22-10-4-3-5-11-22/h6-9,13-14H,3-5,10-12H2,1-2H3,(H,20,24) |
| InChIKey | YFTCOTBKAXBDJO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|