C11H11BrN4O — CID 760474
4-bromo-2-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol (PubChem CID 760474) has the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-bromo-2-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol.
| Compound Name | 4-bromo-2-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 760474 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-bromo-2-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol |
| SMILES | Cc1nnc(C)n1N=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C11H11BrN4O/c1-7-14-15-8(2)16(7)13-6-9-5-10(12)3-4-11(9)17/h3-6,17H,1-2H3 |
| InChIKey | AVBPKESBYDKXKV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|