About (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile
(E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile (PubChem CID 7605374) has the molecular formula C15H10N4
and a molecular weight of 246.27 g/mol. Its IUPAC name is (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile |
| PubChem CID | 7605374 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C15H10N4/c16-10-12(9-11-5-2-1-3-6-11)14-18-13-7-4-8-17-15(13)19-14/h1-9H,(H,17,18,19)/b12-9+ |
| InChIKey | NMGKUHYZYVZSHH-FMIVXFBMSA-N |
| XLogP | 3.02 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile?
The IUPAC name of (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile (CID 7605374) is (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile.
What is the SMILES notation for (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile?
The canonical SMILES for (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile is N#C/C(=C\c1ccccc1)c1nc2ncccc2[nH]1.
What is the InChIKey of (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile?
The InChIKey is NMGKUHYZYVZSHH-FMIVXFBMSA-N. The full InChI is InChI=1S/C15H10N4/c16-10-12(9-11-5-2-1-3-6-11)14-18-13-7-4-8-17-15(13)19-14/h1-9H,(H,17,18,19)/b12-9+.
What are the key properties of (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile?
(E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile has a molecular weight of 246.27 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(1H-imidazo[4,5-b]pyridin-2-yl)-3-phenylprop-2-enenitrile is sourced from PubChem (CID 7605374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).