C16H23N3O3 — CID 7605908
4-nitro-2-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenolate (PubChem CID 7605908) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-nitro-2-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenolate.
| Compound Name | 4-nitro-2-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenolate |
|---|---|
| PubChem CID | 7605908 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-nitro-2-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenolate |
| SMILES | CC1(C)CC(/N=C/c2cc([N+](=O)[O-])ccc2[O-])CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C16H23N3O3/c1-15(2)8-12(9-16(3,4)18-15)17-10-11-7-13(19(21)22)5-6-14(11)20/h5-7,10,12,18,20H,8-9H2,1-4H3/b17-10+ |
| InChIKey | XNQRJCQNXJKZAB-LICLKQGHSA-N |
| XLogP | 1.37 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|