About [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7606096) has the molecular formula C19H28N2O3S2
and a molecular weight of 396.58 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
Molecular Properties
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| PubChem CID | 7606096 |
| Molecular Formula | C19H28N2O3S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CCOc1ccc(CCNC(=O)CSC(=S)N2CCCC2)cc1OCC |
| InChI | InChI=1S/C19H28N2O3S2/c1-3-23-16-8-7-15(13-17(16)24-4-2)9-10-20-18(22)14-26-19(25)21-11-5-6-12-21/h7-8,13H,3-6,9-12,14H2,1-2H3,(H,20,22) |
| InChIKey | WXBUMTLUXBFSKA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate?
The IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (CID 7606096) is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
What is the SMILES notation for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate?
The canonical SMILES for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate is CCOc1ccc(CCNC(=O)CSC(=S)N2CCCC2)cc1OCC.
What is the InChIKey of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate?
The InChIKey is WXBUMTLUXBFSKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3S2/c1-3-23-16-8-7-15(13-17(16)24-4-2)9-10-20-18(22)14-26-19(25)21-11-5-6-12-21/h7-8,13H,3-6,9-12,14H2,1-2H3,(H,20,22).
What are the key properties of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate?
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate has a molecular weight of 396.58 g/mol, XLogP of 3.26, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate is sourced from PubChem (CID 7606096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).