C11H19N3O2S2 — CID 7606506
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 7606506) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606506 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | CC(C)[C@H](SC(=S)N1CCCC1)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H19N3O2S2/c1-7(2)8(9(15)13-10(12)16)18-11(17)14-5-3-4-6-14/h7-8H,3-6H2,1-2H3,(H3,12,13,15,16)/t8-/m0/s1 |
| InChIKey | SZKHSJOYTCBTFN-QMMMGPOBSA-N |
| XLogP | 1.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|