C15H11N3O2S — CID 760742
6-hydroxy-1-phenyl-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 760742) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 6-hydroxy-1-phenyl-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-1-phenyl-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 760742 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 6-hydroxy-1-phenyl-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccccc2)c(O)c1C=C1C=CC=N1 |
| InChI | InChI=1S/C15H11N3O2S/c19-13-12(9-10-5-4-8-16-10)14(20)18(15(21)17-13)11-6-2-1-3-7-11/h1-9,20H,(H,17,19,21) |
| InChIKey | FYXYPVIDCHIFDO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|