About 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline
8-methoxy-2,4-dimethylfuro[3,2-c]quinoline (PubChem CID 760888) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline |
| PubChem CID | 760888 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline |
| SMILES | COc1ccc2nc(C)c3cc(C)oc3c2c1 |
| InChI | InChI=1S/C14H13NO2/c1-8-6-11-9(2)15-13-5-4-10(16-3)7-12(13)14(11)17-8/h4-7H,1-3H3 |
| InChIKey | XJOGBLKKDFNWOG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline?
The IUPAC name of 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline (CID 760888) is 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline.
What is the SMILES notation for 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline?
The canonical SMILES for 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline is COc1ccc2nc(C)c3cc(C)oc3c2c1.
What is the InChIKey of 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline?
The InChIKey is XJOGBLKKDFNWOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-8-6-11-9(2)15-13-5-4-10(16-3)7-12(13)14(11)17-8/h4-7H,1-3H3.
What are the key properties of 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline?
8-methoxy-2,4-dimethylfuro[3,2-c]quinoline has a molecular weight of 227.26 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,4-dimethylfuro[3,2-c]quinoline is sourced from PubChem (CID 760888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).