C13H18N4O4 — CID 7609910
3-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7609910) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7609910 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)N1CCNC1=O |
| InChI | InChI=1S/C13H18N4O4/c18-9(16-7-6-14-11(16)20)8-17-10(19)13(15-12(17)21)4-2-1-3-5-13/h1-8H2,(H,14,20)(H,15,21) |
| InChIKey | WEIFSTYOKUWMQJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|