C19H22N2OS — CID 760997
3-ethyl-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 760997) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 3-ethyl-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 3-ethyl-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 760997 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-ethyl-2-sulfanylidenespiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | CCn1c(=S)[nH]c2c(c1=O)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C19H22N2OS/c1-2-21-17(22)15-16(20-18(21)23)14-9-5-4-8-13(14)12-19(15)10-6-3-7-11-19/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,20,23) |
| InChIKey | ZNRALKLTPOTARD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|