C18H21NO5 — CID 7612549
2-(2,6-dimethoxyphenoxy)-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 7612549) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7612549 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)COc2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-21-14-9-7-13(8-10-14)11-19-17(20)12-24-18-15(22-2)5-4-6-16(18)23-3/h4-10H,11-12H2,1-3H3,(H,19,20) |
| InChIKey | OUUHPDWRFKHYGX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |