About N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide
N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide (PubChem CID 7613699) has the molecular formula C20H29N3O
and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide |
| PubChem CID | 7613699 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1([C@H]2CCCC/C2=N/Nc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H29N3O/c1-16(24)21-20(14-8-3-9-15-20)18-12-6-7-13-19(18)23-22-17-10-4-2-5-11-17/h2,4-5,10-11,18,22H,3,6-9,12-15H2,1H3,(H,21,24)/b23-19-/t18-/m0/s1 |
| InChIKey | MVNWOGDGNANAIL-YBAYSFDISA-N |
| XLogP | 4.48 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide?
The IUPAC name of N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide (CID 7613699) is N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide.
What is the SMILES notation for N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide?
The canonical SMILES for N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide is CC(=O)NC1([C@H]2CCCC/C2=N/Nc2ccccc2)CCCCC1.
What is the InChIKey of N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide?
The InChIKey is MVNWOGDGNANAIL-YBAYSFDISA-N. The full InChI is InChI=1S/C20H29N3O/c1-16(24)21-20(14-8-3-9-15-20)18-12-6-7-13-19(18)23-22-17-10-4-2-5-11-17/h2,4-5,10-11,18,22H,3,6-9,12-15H2,1H3,(H,21,24)/b23-19-/t18-/m0/s1.
What are the key properties of N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide?
N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide has a molecular weight of 327.47 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(1R,2Z)-2-(phenylhydrazinylidene)cyclohexyl]cyclohexyl]acetamide is sourced from PubChem (CID 7613699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).