About N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide
N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide (PubChem CID 7613961) has the molecular formula C10H19NO3S
and a molecular weight of 233.33 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide |
| PubChem CID | 7613961 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO3S/c1-8(2)6-10(12)11(3)9-4-5-15(13,14)7-9/h8-9H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | UBBGZHCUXMJPOH-VIFPVBQESA-N |
| XLogP | 0.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide?
The IUPAC name of N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide (CID 7613961) is N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide.
What is the SMILES notation for N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide?
The canonical SMILES for N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide is CC(C)CC(=O)N(C)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide?
The InChIKey is UBBGZHCUXMJPOH-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19NO3S/c1-8(2)6-10(12)11(3)9-4-5-15(13,14)7-9/h8-9H,4-7H2,1-3H3/t9-/m0/s1.
What are the key properties of N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide?
N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide has a molecular weight of 233.33 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1,1-dioxothiolan-3-yl]-N,3-dimethylbutanamide is sourced from PubChem (CID 7613961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).