C18H17N5O3S — CID 7613983
N'-[2-[[(3S)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 7613983) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is N'-[2-[[(3S)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[(3S)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7613983 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N'-[2-[[(3S)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | CC1(C)C(C#N)=C(SCC(=O)NNC(=O)c2ccccc2)NC(=O)[C@@H]1C#N |
| InChI | InChI=1S/C18H17N5O3S/c1-18(2)12(8-19)16(26)21-17(13(18)9-20)27-10-14(24)22-23-15(25)11-6-4-3-5-7-11/h3-7,12H,10H2,1-2H3,(H,21,26)(H,22,24)(H,23,25)/t12-/m0/s1 |
| InChIKey | HSSLFXKTWLIHDT-LBPRGKRZSA-N |
| XLogP | 1.21 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|