About 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one
4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one (PubChem CID 7613994) has the molecular formula C19H15NO2S2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one.
Molecular Properties
| Compound Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one |
| PubChem CID | 7613994 |
| Molecular Formula | C19H15NO2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CSC3=Nc4ccccc4CS3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15NO2S2/c1-12-6-7-15-14(9-18(21)22-17(15)8-12)11-24-19-20-16-5-3-2-4-13(16)10-23-19/h2-9H,10-11H2,1H3 |
| InChIKey | KUFGDPQFYXLGGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one?
The IUPAC name of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one (CID 7613994) is 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one.
What is the SMILES notation for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one?
The canonical SMILES for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one is Cc1ccc2c(CSC3=Nc4ccccc4CS3)cc(=O)oc2c1.
What is the InChIKey of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one?
The InChIKey is KUFGDPQFYXLGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2S2/c1-12-6-7-15-14(9-18(21)22-17(15)8-12)11-24-19-20-16-5-3-2-4-13(16)10-23-19/h2-9H,10-11H2,1H3.
What are the key properties of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one?
4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one has a molecular weight of 353.47 g/mol, XLogP of 5.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)-7-methylchromen-2-one is sourced from PubChem (CID 7613994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).