About 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole
2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole (PubChem CID 7614378) has the molecular formula C19H16FN5O2S
and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole |
| PubChem CID | 7614378 |
| Molecular Formula | C19H16FN5O2S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(Cn3nnc(-c4ccc(F)cc4)n3)cs2)cc1OC |
| InChI | InChI=1S/C19H16FN5O2S/c1-26-16-8-5-13(9-17(16)27-2)19-21-15(11-28-19)10-25-23-18(22-24-25)12-3-6-14(20)7-4-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | LTTZTJRBNZTVNP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole (CID 7614378) is 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole is COc1ccc(-c2nc(Cn3nnc(-c4ccc(F)cc4)n3)cs2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole?
The InChIKey is LTTZTJRBNZTVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN5O2S/c1-26-16-8-5-13(9-17(16)27-2)19-21-15(11-28-19)10-25-23-18(22-24-25)12-3-6-14(20)7-4-12/h3-9,11H,10H2,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole?
2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole has a molecular weight of 397.44 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-1,3-thiazole is sourced from PubChem (CID 7614378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).