About 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide
4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide (PubChem CID 7614584) has the molecular formula C13H17BrN2O3S
and a molecular weight of 361.26 g/mol. Its IUPAC name is 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide |
| PubChem CID | 7614584 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)N(C(=O)c1ccc(Br)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17BrN2O3S/c1-15(2)16(12-7-8-20(18,19)9-12)13(17)10-3-5-11(14)6-4-10/h3-6,12H,7-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | UGQRSTPBJJPJAE-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide?
The IUPAC name of 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide (CID 7614584) is 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide.
What is the SMILES notation for 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide?
The canonical SMILES for 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide is CN(C)N(C(=O)c1ccc(Br)cc1)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide?
The InChIKey is UGQRSTPBJJPJAE-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H17BrN2O3S/c1-15(2)16(12-7-8-20(18,19)9-12)13(17)10-3-5-11(14)6-4-10/h3-6,12H,7-9H2,1-2H3/t12-/m0/s1.
What are the key properties of 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide?
4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide has a molecular weight of 361.26 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethylbenzohydrazide is sourced from PubChem (CID 7614584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).