C22H32N3O3S+ — CID 7614984
ethyl 2-[2-(2,6-dimethylphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate (PubChem CID 7614984) has the molecular formula C22H32N3O3S+ and a molecular weight of 418.58 g/mol. Its IUPAC name is ethyl 2-[2-(2,6-dimethylphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2,6-dimethylphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7614984 |
| Molecular Formula | C22H32N3O3S+ |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | ethyl 2-[2-(2,6-dimethylphenyl)imino-3-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cs/c(=N\c2c(C)cccc2C)n1CCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H31N3O3S/c1-4-28-20(26)15-19-16-29-22(23-21-17(2)7-5-8-18(21)3)25(19)10-6-9-24-11-13-27-14-12-24/h5,7-8,16H,4,6,9-15H2,1-3H3/p+1/b23-22- |
| InChIKey | STQJDFLVIBHZFU-FCQUAONHSA-O |
| XLogP | 1.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|