About 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde
2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 761582) has the molecular formula C15H11N3O2
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| PubChem CID | 761582 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | O=Cc1c(Nc2ccccc2)nc2ccccn2c1=O |
| InChI | InChI=1S/C15H11N3O2/c19-10-12-14(16-11-6-2-1-3-7-11)17-13-8-4-5-9-18(13)15(12)20/h1-10,16H |
| InChIKey | XJQIAZHXXXQGPZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The IUPAC name of 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (CID 761582) is 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
What is the SMILES notation for 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The canonical SMILES for 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde is O=Cc1c(Nc2ccccc2)nc2ccccn2c1=O.
What is the InChIKey of 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The InChIKey is XJQIAZHXXXQGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2/c19-10-12-14(16-11-6-2-1-3-7-11)17-13-8-4-5-9-18(13)15(12)20/h1-10,16H.
What are the key properties of 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde has a molecular weight of 265.27 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde is sourced from PubChem (CID 761582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).