About N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide
N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 7616027) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide.
Molecular Properties
| Compound Name | N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| PubChem CID | 7616027 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(Nc1c[nH]c2ccccc12)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H17N3O/c22-18(20-16-12-19-15-9-3-2-8-14(15)16)21-11-5-7-13-6-1-4-10-17(13)21/h1-4,6,8-10,12,19H,5,7,11H2,(H,20,22) |
| InChIKey | AGONQRNYJBQTRT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide?
The IUPAC name of N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide (CID 7616027) is N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide.
What is the SMILES notation for N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide?
The canonical SMILES for N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide is O=C(Nc1c[nH]c2ccccc12)N1CCCc2ccccc21.
What is the InChIKey of N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide?
The InChIKey is AGONQRNYJBQTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O/c22-18(20-16-12-19-15-9-3-2-8-14(15)16)21-11-5-7-13-6-1-4-10-17(13)21/h1-4,6,8-10,12,19H,5,7,11H2,(H,20,22).
What are the key properties of N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide?
N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide has a molecular weight of 291.35 g/mol, XLogP of 4.15, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indol-3-yl)-3,4-dihydro-2H-quinoline-1-carboxamide is sourced from PubChem (CID 7616027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).