About 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine
2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine (PubChem CID 761633) has the molecular formula C18H13F3N2
and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine |
| PubChem CID | 761633 |
| Molecular Formula | C18H13F3N2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine |
| SMILES | FC(F)(F)c1ccc(C2Nc3cccc4cccc(c34)N2)cc1 |
| InChI | InChI=1S/C18H13F3N2/c19-18(20,21)13-9-7-12(8-10-13)17-22-14-5-1-3-11-4-2-6-15(23-17)16(11)14/h1-10,17,22-23H |
| InChIKey | NNESIWUNPNCERG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine?
The IUPAC name of 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine (CID 761633) is 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine.
What is the SMILES notation for 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine?
The canonical SMILES for 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine is FC(F)(F)c1ccc(C2Nc3cccc4cccc(c34)N2)cc1.
What is the InChIKey of 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine?
The InChIKey is NNESIWUNPNCERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2/c19-18(20,21)13-9-7-12(8-10-13)17-22-14-5-1-3-11-4-2-6-15(23-17)16(11)14/h1-10,17,22-23H.
What are the key properties of 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine?
2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine has a molecular weight of 314.31 g/mol, XLogP of 5.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-perimidine is sourced from PubChem (CID 761633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).