About [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate
[(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 7617869) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate.
Molecular Properties
| Compound Name | [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
| PubChem CID | 7617869 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)O[C@@H]3CCCCC3=O)coc2c1C |
| InChI | InChI=1S/C18H20O4/c1-11-7-8-14-13(10-21-18(14)12(11)2)9-17(20)22-16-6-4-3-5-15(16)19/h7-8,10,16H,3-6,9H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZALWGYZOWDRIPS-MRXNPFEDSA-N |
| XLogP | 3.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate?
The IUPAC name of [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate (CID 7617869) is [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate.
What is the SMILES notation for [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate?
The canonical SMILES for [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate is Cc1ccc2c(CC(=O)O[C@@H]3CCCCC3=O)coc2c1C.
What is the InChIKey of [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate?
The InChIKey is ZALWGYZOWDRIPS-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H20O4/c1-11-7-8-14-13(10-21-18(14)12(11)2)9-17(20)22-16-6-4-3-5-15(16)19/h7-8,10,16H,3-6,9H2,1-2H3/t16-/m1/s1.
What are the key properties of [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate?
[(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate has a molecular weight of 300.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-oxocyclohexyl] 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate is sourced from PubChem (CID 7617869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).