About [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate
[2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 761855) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate |
| PubChem CID | 761855 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cnccn2)cc1C |
| InChI | InChI=1S/C15H14N2O3/c1-10-3-4-12(7-11(10)2)14(18)9-20-15(19)13-8-16-5-6-17-13/h3-8H,9H2,1-2H3 |
| InChIKey | HIKOIVKWRDMEQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate (CID 761855) is [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate is Cc1ccc(C(=O)COC(=O)c2cnccn2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is HIKOIVKWRDMEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c1-10-3-4-12(7-11(10)2)14(18)9-20-15(19)13-8-16-5-6-17-13/h3-8H,9H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
[2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 270.29 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 761855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).