C18H16N2O4S — CID 7619145
(10aS)-2-(4-methylphenyl)sulfonyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione (PubChem CID 7619145) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (10aS)-2-(4-methylphenyl)sulfonyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione.
| Compound Name | (10aS)-2-(4-methylphenyl)sulfonyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7619145 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (10aS)-2-(4-methylphenyl)sulfonyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@@H]3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-12-6-8-15(9-7-12)25(23,24)20-17(21)16-10-13-4-2-3-5-14(13)11-19(16)18(20)22/h2-9,16H,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | ZTRAJKIJFKZYAW-INIZCTEOSA-N |
| XLogP | 2.07 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|