C18H19N5O4 — CID 7619567
(5R,6'R)-7'-ethyl-1,6'-dimethylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone (PubChem CID 7619567) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is (5R,6'R)-7'-ethyl-1,6'-dimethylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone.
| Compound Name | (5R,6'R)-7'-ethyl-1,6'-dimethylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone |
|---|---|
| PubChem CID | 7619567 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (5R,6'R)-7'-ethyl-1,6'-dimethylspiro[1,3-diazinane-5,5'-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene]-2,2',4,6-tetrone |
| SMILES | CCN1c2nc3ccccn3c(=O)c2C[C@]2(C(=O)NC(=O)N(C)C2=O)[C@H]1C |
| InChI | InChI=1S/C18H19N5O4/c1-4-22-10(2)18(15(25)20-17(27)21(3)16(18)26)9-11-13(22)19-12-7-5-6-8-23(12)14(11)24/h5-8,10H,4,9H2,1-3H3,(H,20,25,27)/t10-,18-/m1/s1 |
| InChIKey | PQGLDAGJJPGXHO-MLCYQJTMSA-N |
| XLogP | 0.16 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|