C18H21N3O5 — CID 7619833
N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619833) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619833 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1c(=O)c(C(=O)NC[C@]2(OC)C=C[C@H](OC)O2)cc2cccnc21 |
| InChI | InChI=1S/C18H21N3O5/c1-4-21-15-12(6-5-9-19-15)10-13(17(21)23)16(22)20-11-18(25-3)8-7-14(24-2)26-18/h5-10,14H,4,11H2,1-3H3,(H,20,22)/t14-,18+/m1/s1 |
| InChIKey | KQINDVBIOLWJMG-KDOFPFPSSA-N |
| XLogP | 1.05 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|