C23H25N3O2 — CID 7620050
1-benzyl-3-[(2R)-2-ethylpiperidine-1-carbonyl]-1,8-naphthyridin-2-one (PubChem CID 7620050) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-benzyl-3-[(2R)-2-ethylpiperidine-1-carbonyl]-1,8-naphthyridin-2-one.
| Compound Name | 1-benzyl-3-[(2R)-2-ethylpiperidine-1-carbonyl]-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 7620050 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-benzyl-3-[(2R)-2-ethylpiperidine-1-carbonyl]-1,8-naphthyridin-2-one |
| SMILES | CC[C@@H]1CCCCN1C(=O)c1cc2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H25N3O2/c1-2-19-12-6-7-14-25(19)22(27)20-15-18-11-8-13-24-21(18)26(23(20)28)16-17-9-4-3-5-10-17/h3-5,8-11,13,15,19H,2,6-7,12,14,16H2,1H3/t19-/m1/s1 |
| InChIKey | FQSBBNUXOABMNN-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |