C21H16N4O2 — CID 7620300
1-benzyl-2-oxo-N-pyridin-3-yl-1,8-naphthyridine-3-carboxamide (PubChem CID 7620300) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-benzyl-2-oxo-N-pyridin-3-yl-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-benzyl-2-oxo-N-pyridin-3-yl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7620300 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-benzyl-2-oxo-N-pyridin-3-yl-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1cc2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H16N4O2/c26-20(24-17-9-5-10-22-13-17)18-12-16-8-4-11-23-19(16)25(21(18)27)14-15-6-2-1-3-7-15/h1-13H,14H2,(H,24,26) |
| InChIKey | URKCCRDDEUQXNZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |