C10H18F3N3O — CID 76206085
5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxypentanimidamide (PubChem CID 76206085) has the molecular formula C10H18F3N3O and a molecular weight of 253.26 g/mol. Its IUPAC name is 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 76206085 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxypentanimidamide |
| SMILES | C1CC1N(CCCCC(=NO)N)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O/c11-10(12,13)7-16(8-4-5-8)6-2-1-3-9(14)15-17/h8,17H,1-7H2,(H2,14,15) |
| InChIKey | XPXFATMHQDWGLG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | 264 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|