About 2-(dibutylamino)ethanol
2-(dibutylamino)ethanol (PubChem CID 7621) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 2-(dibutylamino)ethanol.
Molecular Properties
| Compound Name | 2-(dibutylamino)ethanol |
| PubChem CID | 7621 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 2-(dibutylamino)ethanol |
| SMILES | CCCCN(CCO)CCCC |
| InChI | InChI=1S/C10H23NO/c1-3-5-7-11(9-10-12)8-6-4-2/h12H,3-10H2,1-2H3 |
| InChIKey | IWSZDQRGNFLMJS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dibutylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)ethanol?
The IUPAC name of 2-(dibutylamino)ethanol (CID 7621) is 2-(dibutylamino)ethanol.
What is the SMILES notation for 2-(dibutylamino)ethanol?
The canonical SMILES for 2-(dibutylamino)ethanol is CCCCN(CCO)CCCC.
What is the InChIKey of 2-(dibutylamino)ethanol?
The InChIKey is IWSZDQRGNFLMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-3-5-7-11(9-10-12)8-6-4-2/h12H,3-10H2,1-2H3.
What are the key properties of 2-(dibutylamino)ethanol?
2-(dibutylamino)ethanol has a molecular weight of 173.30 g/mol, XLogP of 1.88, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)ethanol is sourced from PubChem (CID 7621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).